C25H25ClN2O5S — CID 46778522
ethyl 2-chloro-4-[[4-[(3-methyl-N-methylsulfonylanilino)methyl]benzoyl]amino]benzoate (PubChem CID 46778522) has the molecular formula C25H25ClN2O5S and a molecular weight of 501.00 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[4-[(3-methyl-N-methylsulfonylanilino)methyl]benzoyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[4-[(3-methyl-N-methylsulfonylanilino)methyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 46778522 |
| Molecular Formula | C25H25ClN2O5S |
| Molecular Weight | 501.00 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | ethyl 2-chloro-4-[[4-[(3-methyl-N-methylsulfonylanilino)methyl]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc(CN(c3cccc(C)c3)S(C)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C25H25ClN2O5S/c1-4-33-25(30)22-13-12-20(15-23(22)26)27-24(29)19-10-8-18(9-11-19)16-28(34(3,31)32)21-7-5-6-17(2)14-21/h5-15H,4,16H2,1-3H3,(H,27,29) |
| InChIKey | WPFJEKGOMAUEJA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.00 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |