C22H30N2O4S — CID 46778633
2-(4-ethoxy-N-methylsulfonylanilino)-N-(3-methyl-1-phenylbutyl)acetamide (PubChem CID 46778633) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is 2-(4-ethoxy-N-methylsulfonylanilino)-N-(3-methyl-1-phenylbutyl)acetamide.
| Compound Name | 2-(4-ethoxy-N-methylsulfonylanilino)-N-(3-methyl-1-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 46778633 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-(4-ethoxy-N-methylsulfonylanilino)-N-(3-methyl-1-phenylbutyl)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NC(CC(C)C)c2ccccc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H30N2O4S/c1-5-28-20-13-11-19(12-14-20)24(29(4,26)27)16-22(25)23-21(15-17(2)3)18-9-7-6-8-10-18/h6-14,17,21H,5,15-16H2,1-4H3,(H,23,25) |
| InChIKey | KBJZSWPRBFPEIL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |