About 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine
2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine (PubChem CID 46779053) has the molecular formula C13H13F6N2O2-
and a molecular weight of 343.25 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine.
Molecular Properties
| Compound Name | 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine |
| PubChem CID | 46779053 |
| Molecular Formula | C13H13F6N2O2- |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1ccc(N2CCNCC2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2.C2HF3O2/c12-11(13,14)9-1-3-10(4-2-9)16-7-5-15-6-8-16;3-2(4,5)1(6)7/h1-4,15H,5-8H2;(H,6,7)/p-1 |
| InChIKey | SQHIPBGRLZCTBO-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine?
The IUPAC name of 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine (CID 46779053) is 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine.
What is the SMILES notation for 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine?
The canonical SMILES for 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine is FC(F)(F)c1ccc(N2CCNCC2)cc1.O=C([O-])C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine?
The InChIKey is SQHIPBGRLZCTBO-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H13F3N2.C2HF3O2/c12-11(13,14)9-1-3-10(4-2-9)16-7-5-15-6-8-16;3-2(4,5)1(6)7/h1-4,15H,5-8H2;(H,6,7)/p-1.
What are the key properties of 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine?
2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine has a molecular weight of 343.25 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroacetate;1-[4-(trifluoromethyl)phenyl]piperazine is sourced from PubChem (CID 46779053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).