C16H24N2O3 — CID 46780194
5-[3-(tert-butylamino)-1,1,2,3,3-pentadeuterio-2-hydroxypropoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 46780194) has the molecular formula C16H24N2O3 and a molecular weight of 297.41 g/mol. Its IUPAC name is 5-[3-(tert-butylamino)-1,1,2,3,3-pentadeuterio-2-hydroxypropoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-[3-(tert-butylamino)-1,1,2,3,3-pentadeuterio-2-hydroxypropoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 46780194 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 5-[3-(tert-butylamino)-1,1,2,3,3-pentadeuterio-2-hydroxypropoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | [2H]C([2H])(NC(C)(C)C)C([2H])(O)C([2H])([2H])Oc1cccc2c1CCC(=O)N2 |
| InChI | InChI=1S/C16H24N2O3/c1-16(2,3)17-9-11(19)10-21-14-6-4-5-13-12(14)7-8-15(20)18-13/h4-6,11,17,19H,7-10H2,1-3H3,(H,18,20)/i9D2,10D2,11D |
| InChIKey | LWAFSWPYPHEXKX-VFNCYXODSA-N |
| XLogP | 1.70 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |