About 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline
2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline (PubChem CID 46780531) has the molecular formula C12H10N6
and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline.
Molecular Properties
| Compound Name | 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline |
| PubChem CID | 46780531 |
| Molecular Formula | C12H10N6 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline |
| SMILES | [2H]C([2H])([2H])n1c(N=[N+]=[N-])nc2c3cccnc3cc(C)c21 |
| InChI | InChI=1S/C12H10N6/c1-7-6-9-8(4-3-5-14-9)10-11(7)18(2)12(15-10)16-17-13/h3-6H,1-2H3/i2D3 |
| InChIKey | GUYGDZSFLARRCN-BMSJAHLVSA-N |
| XLogP | 3.37 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline?
The IUPAC name of 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline (CID 46780531) is 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline.
What is the SMILES notation for 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline?
The canonical SMILES for 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline is [2H]C([2H])([2H])n1c(N=[N+]=[N-])nc2c3cccnc3cc(C)c21.
What is the InChIKey of 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline?
The InChIKey is GUYGDZSFLARRCN-BMSJAHLVSA-N. The full InChI is InChI=1S/C12H10N6/c1-7-6-9-8(4-3-5-14-9)10-11(7)18(2)12(15-10)16-17-13/h3-6H,1-2H3/i2D3.
What are the key properties of 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline?
2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline has a molecular weight of 241.27 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-4-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoline is sourced from PubChem (CID 46780531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).