About decanoate
decanoate (PubChem CID 4678093) has the molecular formula C10H19O2-
and a molecular weight of 171.26 g/mol. Its IUPAC name is decanoate.
Molecular Properties
| Compound Name | decanoate |
| PubChem CID | 4678093 |
| Molecular Formula | C10H19O2- |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | decanoate |
| SMILES | CCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/p-1 |
| InChIKey | GHVNFZFCNZKVNT-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanoate?
The IUPAC name of decanoate (CID 4678093) is decanoate.
What is the SMILES notation for decanoate?
The canonical SMILES for decanoate is CCCCCCCCCC(=O)[O-].
What is the InChIKey of decanoate?
The InChIKey is GHVNFZFCNZKVNT-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/p-1.
What are the key properties of decanoate?
decanoate has a molecular weight of 171.26 g/mol, XLogP of 1.88, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decanoate is sourced from PubChem (CID 4678093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).