About 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid
2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid (PubChem CID 46780948) has the molecular formula C10H18O4
and a molecular weight of 205.27 g/mol. Its IUPAC name is 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid |
| PubChem CID | 46780948 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid |
| SMILES | [2H]C([2H])([2H])C1(C(=O)O)COC(C(C)(C)C)OC1 |
| InChI | InChI=1S/C10H18O4/c1-9(2,3)8-13-5-10(4,6-14-8)7(11)12/h8H,5-6H2,1-4H3,(H,11,12)/i4D3 |
| InChIKey | KTTYIKKAGVPDJZ-GKOSEXJESA-N |
| XLogP | 1.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid?
The IUPAC name of 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid (CID 46780948) is 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid.
What is the SMILES notation for 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid?
The canonical SMILES for 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid is [2H]C([2H])([2H])C1(C(=O)O)COC(C(C)(C)C)OC1.
What is the InChIKey of 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid?
The InChIKey is KTTYIKKAGVPDJZ-GKOSEXJESA-N. The full InChI is InChI=1S/C10H18O4/c1-9(2,3)8-13-5-10(4,6-14-8)7(11)12/h8H,5-6H2,1-4H3,(H,11,12)/i4D3.
What are the key properties of 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid?
2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid has a molecular weight of 205.27 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(trideuteriomethyl)-1,3-dioxane-5-carboxylic acid is sourced from PubChem (CID 46780948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).