C16H19ClO9 — CID 46781046
(3R,4R,5R,6R)-6-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 46781046) has the molecular formula C16H19ClO9 and a molecular weight of 390.77 g/mol. Its IUPAC name is (3R,4R,5R,6R)-6-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3R,4R,5R,6R)-6-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 46781046 |
| Molecular Formula | C16H19ClO9 |
| Molecular Weight | 390.77 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (3R,4R,5R,6R)-6-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)O[C@H]1OC(C(=O)O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H19ClO9/c1-16(2,26-8-5-3-7(17)4-6-8)15(23)25-14-11(20)9(18)10(19)12(24-14)13(21)22/h3-6,9-12,14,18-20H,1-2H3,(H,21,22)/t9-,10-,11-,12?,14-/m1/s1 |
| InChIKey | LCJVUUVMVSSIGZ-VEBUNCRRSA-N |
| XLogP | -0.07 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.77 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |