C7H11NO2 — CID 46781517
3-Methyl-3-(2,2,2-trideuterioethyl)pyrrolidine-2,5-dione (PubChem CID 46781517) has the molecular formula C7H11NO2 and a molecular weight of 144.19 g/mol. Its IUPAC name is 3-methyl-3-(2,2,2-trideuterioethyl)pyrrolidine-2,5-dione.
| Compound Name | 3-Methyl-3-(2,2,2-trideuterioethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 46781517 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 3-methyl-3-(2,2,2-trideuterioethyl)pyrrolidine-2,5-dione |
| SMILES | [2H]C([2H])([2H])CC1(CC(=O)NC1=O)C |
| InChI | InChI=1S/C7H11NO2/c1-3-7(2)4-5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10)/i1D3 |
| InChIKey | HAPOVYFOVVWLRS-FIBGUPNXSA-N |
| XLogP | 0.40 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 188 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|