C3H6N6 — CID 46782115
1,3,5-triazine-2,4,6-tri(15N3)amine (PubChem CID 46782115) has the molecular formula C3H6N6 and a molecular weight of 129.10 g/mol. Its IUPAC name is 1,3,5-triazine-2,4,6-tri(15N3)amine.
| Compound Name | 1,3,5-triazine-2,4,6-tri(15N3)amine |
|---|---|
| PubChem CID | 46782115 |
| Molecular Formula | C3H6N6 |
| Molecular Weight | 129.10 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 1,3,5-triazine-2,4,6-tri(15N3)amine |
| SMILES | [15NH2]c1nc([15NH2])nc([15NH2])n1 |
| InChI | InChI=1S/C3H6N6/c4-1-7-2(5)9-3(6)8-1/h(H6,4,5,6,7,8,9)/i4+1,5+1,6+1 |
| InChIKey | JDSHMPZPIAZGSV-VMGGCIAMSA-N |
| XLogP | -1.38 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.10 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |