C9H18Cl3N2O2P — CID 46783210
N,N,3-tris(2-chloroethyl)-4,4,5,5-tetradeuterio-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine (PubChem CID 46783210) has the molecular formula C9H18Cl3N2O2P and a molecular weight of 327.61 g/mol. Its IUPAC name is N,N,3-tris(2-chloroethyl)-4,4,5,5-tetradeuterio-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
| Compound Name | N,N,3-tris(2-chloroethyl)-4,4,5,5-tetradeuterio-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
|---|---|
| PubChem CID | 46783210 |
| Molecular Formula | C9H18Cl3N2O2P |
| Molecular Weight | 327.61 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N,N,3-tris(2-chloroethyl)-4,4,5,5-tetradeuterio-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
| SMILES | [2H]C1([2H])COP(=O)(N(CCCl)CCCl)N(CCCl)C1([2H])[2H] |
| InChI | InChI=1S/C9H18Cl3N2O2P/c10-2-6-13-5-1-9-16-17(13,15)14(7-3-11)8-4-12/h1-9H2/i1D2,5D2 |
| InChIKey | UMKFEPPTGMDVMI-QEOHIWEKSA-N |
| XLogP | 2.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|