About 4-oxopyran-2,6-dicarboxylate
4-oxopyran-2,6-dicarboxylate (PubChem CID 4678324) has the molecular formula C7H2O6-2
and a molecular weight of 182.09 g/mol. Its IUPAC name is 4-oxopyran-2,6-dicarboxylate.
Molecular Properties
| Compound Name | 4-oxopyran-2,6-dicarboxylate |
| PubChem CID | 4678324 |
| Molecular Formula | C7H2O6-2 |
| Molecular Weight | 182.09 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | 4-oxopyran-2,6-dicarboxylate |
| SMILES | O=C([O-])c1cc(=O)cc(C(=O)[O-])o1 |
| InChI | InChI=1S/C7H4O6/c8-3-1-4(6(9)10)13-5(2-3)7(11)12/h1-2H,(H,9,10)(H,11,12)/p-2 |
| InChIKey | PBAYDYUZOSNJGU-UHFFFAOYSA-L |
| XLogP | -2.63 |
| TPSA | 110.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.09 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-oxopyran-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopyran-2,6-dicarboxylate?
The IUPAC name of 4-oxopyran-2,6-dicarboxylate (CID 4678324) is 4-oxopyran-2,6-dicarboxylate.
What is the SMILES notation for 4-oxopyran-2,6-dicarboxylate?
The canonical SMILES for 4-oxopyran-2,6-dicarboxylate is O=C([O-])c1cc(=O)cc(C(=O)[O-])o1.
What is the InChIKey of 4-oxopyran-2,6-dicarboxylate?
The InChIKey is PBAYDYUZOSNJGU-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H4O6/c8-3-1-4(6(9)10)13-5(2-3)7(11)12/h1-2H,(H,9,10)(H,11,12)/p-2.
What are the key properties of 4-oxopyran-2,6-dicarboxylate?
4-oxopyran-2,6-dicarboxylate has a molecular weight of 182.09 g/mol, XLogP of -2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopyran-2,6-dicarboxylate is sourced from PubChem (CID 4678324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).