About 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium
4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium (PubChem CID 46784066) has the molecular formula C35H37N2+
and a molecular weight of 485.70 g/mol. Its IUPAC name is 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium.
Molecular Properties
| Compound Name | 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium |
| PubChem CID | 46784066 |
| Molecular Formula | C35H37N2+ |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium |
| SMILES | C(=C/c1ccccc1)\C[N+]1(C/C=C/c2ccccc2)CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C35H37N2/c1-5-15-31(16-6-1)19-13-27-37(28-14-20-32-17-7-2-8-18-32)29-25-36(26-30-37)35(33-21-9-3-10-22-33)34-23-11-4-12-24-34/h1-24,35H,25-30H2/q+1/b19-13+,20-14+ |
| InChIKey | QXZCSGDPXZSPCP-IWGRKNQJSA-N |
| XLogP | 7.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium?
The IUPAC name of 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium (CID 46784066) is 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium.
What is the SMILES notation for 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium?
The canonical SMILES for 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium is C(=C/c1ccccc1)\C[N+]1(C/C=C/c2ccccc2)CCN(C(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium?
The InChIKey is QXZCSGDPXZSPCP-IWGRKNQJSA-N. The full InChI is InChI=1S/C35H37N2/c1-5-15-31(16-6-1)19-13-27-37(28-14-20-32-17-7-2-8-18-32)29-25-36(26-30-37)35(33-21-9-3-10-22-33)34-23-11-4-12-24-34/h1-24,35H,25-30H2/q+1/b19-13+,20-14+.
What are the key properties of 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium?
4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium has a molecular weight of 485.70 g/mol, XLogP of 7.34, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzhydryl-1,1-bis[(E)-3-phenylprop-2-enyl]piperazin-1-ium is sourced from PubChem (CID 46784066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).