C6H10N2S — CID 46784246
N-methyl-1-(1,3-thiazol-4-yl)ethanamine (PubChem CID 46784246) has the molecular formula C6H10N2S and a molecular weight of 142.23 g/mol. Its IUPAC name is N-methyl-1-(1,3-thiazol-4-yl)ethanamine.
| Compound Name | N-methyl-1-(1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 46784246 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | N-methyl-1-(1,3-thiazol-4-yl)ethanamine |
| SMILES | CNC(C)c1cscn1 |
| InChI | InChI=1S/C6H10N2S/c1-5(7-2)6-3-9-4-8-6/h3-5,7H,1-2H3 |
| InChIKey | QUTNDUPNKQCSGD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |