About 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine
2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine (PubChem CID 46784293) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine |
| PubChem CID | 46784293 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine |
| SMILES | Cc1nc(CNCCC2CCOCC2)n(C)c1C |
| InChI | InChI=1S/C14H25N3O/c1-11-12(2)17(3)14(16-11)10-15-7-4-13-5-8-18-9-6-13/h13,15H,4-10H2,1-3H3 |
| InChIKey | ZKAKFOJRQHTIMS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine?
The IUPAC name of 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine (CID 46784293) is 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine.
What is the SMILES notation for 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine?
The canonical SMILES for 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine is Cc1nc(CNCCC2CCOCC2)n(C)c1C.
What is the InChIKey of 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine?
The InChIKey is ZKAKFOJRQHTIMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c1-11-12(2)17(3)14(16-11)10-15-7-4-13-5-8-18-9-6-13/h13,15H,4-10H2,1-3H3.
What are the key properties of 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine?
2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine has a molecular weight of 251.37 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-yl)-N-[(1,4,5-trimethylimidazol-2-yl)methyl]ethanamine is sourced from PubChem (CID 46784293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).