C18H18N4O5 — CID 4678483
4-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propylamino]-4-oxobutanoic acid (PubChem CID 4678483) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is 4-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propylamino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 4678483 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propylamino]-4-oxobutanoic acid |
| SMILES | N#Cc1cc2cc3c(cc2nc1NCCCNC(=O)CCC(=O)O)OCO3 |
| InChI | InChI=1S/C18H18N4O5/c19-9-12-6-11-7-14-15(27-10-26-14)8-13(11)22-18(12)21-5-1-4-20-16(23)2-3-17(24)25/h6-8H,1-5,10H2,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | OAWYUTSVGSLZBS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|