C8H11NOS — CID 46784931
4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanol (PubChem CID 46784931) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanol.
| Compound Name | 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanol |
|---|---|
| PubChem CID | 46784931 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanol |
| SMILES | OCc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C8H11NOS/c10-5-8-9-6-3-1-2-4-7(6)11-8/h10H,1-5H2 |
| InChIKey | MZQZKCUGRSNVFJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |