C10H16N2OS — CID 46784936
2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethylamino)ethanol (PubChem CID 46784936) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethylamino)ethanol.
| Compound Name | 2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethylamino)ethanol |
|---|---|
| PubChem CID | 46784936 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethylamino)ethanol |
| SMILES | OCCNCc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C10H16N2OS/c13-6-5-11-7-10-12-8-3-1-2-4-9(8)14-10/h11,13H,1-7H2 |
| InChIKey | ULCUQFSNVLMHJN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|