About cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine
cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine (PubChem CID 46785178) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine.
Molecular Properties
| Compound Name | cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine |
| PubChem CID | 46785178 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine |
| SMILES | Cc1cnc(C(N)C2CC2)s1 |
| InChI | InChI=1S/C8H12N2S/c1-5-4-10-8(11-5)7(9)6-2-3-6/h4,6-7H,2-3,9H2,1H3 |
| InChIKey | FLZXXKPDILZZGE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine?
The IUPAC name of cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine (CID 46785178) is cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine.
What is the SMILES notation for cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine?
The canonical SMILES for cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine is Cc1cnc(C(N)C2CC2)s1.
What is the InChIKey of cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine?
The InChIKey is FLZXXKPDILZZGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S/c1-5-4-10-8(11-5)7(9)6-2-3-6/h4,6-7H,2-3,9H2,1H3.
What are the key properties of cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine?
cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine has a molecular weight of 168.26 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(5-methyl-1,3-thiazol-2-yl)methanamine is sourced from PubChem (CID 46785178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).