About 2-methoxy-1-(1,3-thiazol-2-yl)ethanol
2-methoxy-1-(1,3-thiazol-2-yl)ethanol (PubChem CID 46785207) has the molecular formula C6H9NO2S
and a molecular weight of 159.21 g/mol. Its IUPAC name is 2-methoxy-1-(1,3-thiazol-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-methoxy-1-(1,3-thiazol-2-yl)ethanol |
| PubChem CID | 46785207 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 2-methoxy-1-(1,3-thiazol-2-yl)ethanol |
| SMILES | COCC(O)c1nccs1 |
| InChI | InChI=1S/C6H9NO2S/c1-9-4-5(8)6-7-2-3-10-6/h2-3,5,8H,4H2,1H3 |
| InChIKey | CPBLBIZMGLWKAW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-1-(1,3-thiazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-(1,3-thiazol-2-yl)ethanol?
The IUPAC name of 2-methoxy-1-(1,3-thiazol-2-yl)ethanol (CID 46785207) is 2-methoxy-1-(1,3-thiazol-2-yl)ethanol.
What is the SMILES notation for 2-methoxy-1-(1,3-thiazol-2-yl)ethanol?
The canonical SMILES for 2-methoxy-1-(1,3-thiazol-2-yl)ethanol is COCC(O)c1nccs1.
What is the InChIKey of 2-methoxy-1-(1,3-thiazol-2-yl)ethanol?
The InChIKey is CPBLBIZMGLWKAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2S/c1-9-4-5(8)6-7-2-3-10-6/h2-3,5,8H,4H2,1H3.
What are the key properties of 2-methoxy-1-(1,3-thiazol-2-yl)ethanol?
2-methoxy-1-(1,3-thiazol-2-yl)ethanol has a molecular weight of 159.21 g/mol, XLogP of 0.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-(1,3-thiazol-2-yl)ethanol is sourced from PubChem (CID 46785207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).