C20H25N5O4S — CID 46786082
N-[2-(2-propylphenoxy)ethyl]-4-[2-(tetrazol-1-yl)ethoxy]benzenesulfonamide (PubChem CID 46786082) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[2-(2-propylphenoxy)ethyl]-4-[2-(tetrazol-1-yl)ethoxy]benzenesulfonamide.
| Compound Name | N-[2-(2-propylphenoxy)ethyl]-4-[2-(tetrazol-1-yl)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 46786082 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[2-(2-propylphenoxy)ethyl]-4-[2-(tetrazol-1-yl)ethoxy]benzenesulfonamide |
| SMILES | CCCc1ccccc1OCCNS(=O)(=O)c1ccc(OCCn2cnnn2)cc1 |
| InChI | InChI=1S/C20H25N5O4S/c1-2-5-17-6-3-4-7-20(17)29-14-12-22-30(26,27)19-10-8-18(9-11-19)28-15-13-25-16-21-23-24-25/h3-4,6-11,16,22H,2,5,12-15H2,1H3 |
| InChIKey | FXUBWLTXJFSMFH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|