C22H19N3O8 — CID 46788945
[2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46788945) has the molecular formula C22H19N3O8 and a molecular weight of 453.41 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46788945 |
| Molecular Formula | C22H19N3O8 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCC(=O)NC(=O)Nc1ccc2c(c1)OCCO2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H19N3O8/c1-12(25-19(27)14-4-2-3-5-15(14)20(25)28)21(29)33-11-18(26)24-22(30)23-13-6-7-16-17(10-13)32-9-8-31-16/h2-7,10,12H,8-9,11H2,1H3,(H2,23,24,26,30) |
| InChIKey | YHFRXUAWHTVSGV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|