C15H12ClN5O3S2 — CID 46789692
N-(2-chloro-4-nitrophenyl)-2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 46789692) has the molecular formula C15H12ClN5O3S2 and a molecular weight of 409.88 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 46789692 |
| Molecular Formula | C15H12ClN5O3S2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1n[nH]c(-c2cccs2)n1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H12ClN5O3S2/c1-8(26-15-18-13(19-20-15)12-3-2-6-25-12)14(22)17-11-5-4-9(21(23)24)7-10(11)16/h2-8H,1H3,(H,17,22)(H,18,19,20) |
| InChIKey | TTZPFOZCAKKEOT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|