C24H30N2O7 — CID 46789881
ethyl 1-[2-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 46789881) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is ethyl 1-[2-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46789881 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | ethyl 1-[2-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)C(CC(C)C)N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C24H30N2O7/c1-4-32-23(30)16-9-11-25(12-10-16)20(27)14-33-24(31)19(13-15(2)3)26-21(28)17-7-5-6-8-18(17)22(26)29/h5-8,15-16,19H,4,9-14H2,1-3H3 |
| InChIKey | XHKMQPGBCFNHLY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|