C17H15N3O3 — CID 4679028
2-(1,3-dioxoisoindol-2-yl)-N-(3-methyl-2-pyridinyl)propanamide (PubChem CID 4679028) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(3-methyl-2-pyridinyl)propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(3-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 4679028 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(3-methyl-2-pyridinyl)propanamide |
| SMILES | Cc1cccnc1NC(=O)C(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H15N3O3/c1-10-6-5-9-18-14(10)19-15(21)11(2)20-16(22)12-7-3-4-8-13(12)17(20)23/h3-9,11H,1-2H3,(H,18,19,21) |
| InChIKey | IOLBMBBSJAUMQT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|