C20H22N2O7S2 — CID 46792312
dimethyl 3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)oxymethyl]-5-aminothiophene-2,4-dicarboxylate (PubChem CID 46792312) has the molecular formula C20H22N2O7S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is dimethyl 3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)oxymethyl]-5-aminothiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)oxymethyl]-5-aminothiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 46792312 |
| Molecular Formula | C20H22N2O7S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | dimethyl 3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)oxymethyl]-5-aminothiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1COC(=O)c1c(NC(C)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C20H22N2O7S2/c1-9(23)22-17-14(10-6-4-5-7-12(10)30-17)19(25)29-8-11-13(18(24)27-2)16(21)31-15(11)20(26)28-3/h4-8,21H2,1-3H3,(H,22,23) |
| InChIKey | IDFSIDQRMIVEFU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|