C24H18N4O3 — CID 46794924
2-(4-cyanophenoxy)ethyl 1,5-diphenyl-1,2,4-triazole-3-carboxylate (PubChem CID 46794924) has the molecular formula C24H18N4O3 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 1,5-diphenyl-1,2,4-triazole-3-carboxylate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 1,5-diphenyl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 46794924 |
| Molecular Formula | C24H18N4O3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 1,5-diphenyl-1,2,4-triazole-3-carboxylate |
| SMILES | N#Cc1ccc(OCCOC(=O)c2nc(-c3ccccc3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H18N4O3/c25-17-18-11-13-21(14-12-18)30-15-16-31-24(29)22-26-23(19-7-3-1-4-8-19)28(27-22)20-9-5-2-6-10-20/h1-14H,15-16H2 |
| InChIKey | IXBCBHBUGYONRI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|