C23H26FN3O3 — CID 4679519
3-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-N-pentylpyrazole-5-carboxamide (PubChem CID 4679519) has the molecular formula C23H26FN3O3 and a molecular weight of 411.48 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-N-pentylpyrazole-5-carboxamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-N-pentylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4679519 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-N-pentylpyrazole-5-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(-c2ccc(OC)cc2OC)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN3O3/c1-4-5-6-13-25-23(28)21-15-20(19-12-11-18(29-2)14-22(19)30-3)26-27(21)17-9-7-16(24)8-10-17/h7-12,14-15H,4-6,13H2,1-3H3,(H,25,28) |
| InChIKey | MQDLZQYBRNWGCG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|