C19H31N3O3 — CID 46798188
3-(1-adamantylcarbamoylamino)-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 46798188) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 3-(1-adamantylcarbamoylamino)-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-(1-adamantylcarbamoylamino)-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 46798188 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 3-(1-adamantylcarbamoylamino)-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | O=C(CCNC(=O)NC12CC3CC(CC(C3)C1)C2)NCC1CCCO1 |
| InChI | InChI=1S/C19H31N3O3/c23-17(21-12-16-2-1-5-25-16)3-4-20-18(24)22-19-9-13-6-14(10-19)8-15(7-13)11-19/h13-16H,1-12H2,(H,21,23)(H2,20,22,24) |
| InChIKey | RINGAPQVLQEMMX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |