C18H12ClF3N2O3 — CID 46799380
(E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-2-cyano-N-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 46799380) has the molecular formula C18H12ClF3N2O3 and a molecular weight of 396.75 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-2-cyano-N-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-2-cyano-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46799380 |
| Molecular Formula | C18H12ClF3N2O3 |
| Molecular Weight | 396.75 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | (E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-2-cyano-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2ccccc2C(F)(F)F)cc(Cl)c1O |
| InChI | InChI=1S/C18H12ClF3N2O3/c1-27-15-8-10(7-13(19)16(15)25)6-11(9-23)17(26)24-14-5-3-2-4-12(14)18(20,21)22/h2-8,25H,1H3,(H,24,26)/b11-6+ |
| InChIKey | HAFPGPXQQYKSPK-IZZDOVSWSA-N |
| XLogP | 4.62 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.75 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|