C20H19NO4S — CID 46799948
N-(1-naphthalen-1-ylethyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 46799948) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(1-naphthalen-1-ylethyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 46799948 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc2c(c1)OCCO2)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H19NO4S/c1-14(17-8-4-6-15-5-2-3-7-18(15)17)21-26(22,23)16-9-10-19-20(13-16)25-12-11-24-19/h2-10,13-14,21H,11-12H2,1H3 |
| InChIKey | LIKHPGXQEPKRJP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |