C22H33N3O3S — CID 46801157
2-[4-(benzenesulfonyl)piperazin-1-yl]-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanamide (PubChem CID 46801157) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanamide.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 46801157 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanamide |
| SMILES | CC(NC(=O)C(C)N1CCN(S(=O)(=O)c2ccccc2)CC1)C1CC2CCC1C2 |
| InChI | InChI=1S/C22H33N3O3S/c1-16(21-15-18-8-9-19(21)14-18)23-22(26)17(2)24-10-12-25(13-11-24)29(27,28)20-6-4-3-5-7-20/h3-7,16-19,21H,8-15H2,1-2H3,(H,23,26) |
| InChIKey | ZTMVTOCDIWPCNO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |