About 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione
6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione (PubChem CID 46801608) has the molecular formula C15H21F3N4O3
and a molecular weight of 362.35 g/mol. Its IUPAC name is 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione |
| PubChem CID | 46801608 |
| Molecular Formula | C15H21F3N4O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione |
| SMILES | CC(C(=O)c1c(N)n(C)c(=O)n(C)c1=O)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H21F3N4O3/c1-8(22-6-4-5-9(7-22)15(16,17)18)11(23)10-12(19)20(2)14(25)21(3)13(10)24/h8-9H,4-7,19H2,1-3H3 |
| InChIKey | JIVGYFZFLGISJT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione?
The IUPAC name of 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione (CID 46801608) is 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione?
The canonical SMILES for 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione is CC(C(=O)c1c(N)n(C)c(=O)n(C)c1=O)N1CCCC(C(F)(F)F)C1.
What is the InChIKey of 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione?
The InChIKey is JIVGYFZFLGISJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F3N4O3/c1-8(22-6-4-5-9(7-22)15(16,17)18)11(23)10-12(19)20(2)14(25)21(3)13(10)24/h8-9H,4-7,19H2,1-3H3.
What are the key properties of 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione?
6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione has a molecular weight of 362.35 g/mol, XLogP of 0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,3-dimethyl-5-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]pyrimidine-2,4-dione is sourced from PubChem (CID 46801608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).