C18H26ClN3O2 — CID 46801701
2-[(2-chlorophenyl)methyl-methylamino]-N-(cyclohexylcarbamoyl)propanamide (PubChem CID 46801701) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylamino]-N-(cyclohexylcarbamoyl)propanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(cyclohexylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 46801701 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(cyclohexylcarbamoyl)propanamide |
| SMILES | CC(C(=O)NC(=O)NC1CCCCC1)N(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H26ClN3O2/c1-13(22(2)12-14-8-6-7-11-16(14)19)17(23)21-18(24)20-15-9-4-3-5-10-15/h6-8,11,13,15H,3-5,9-10,12H2,1-2H3,(H2,20,21,23,24) |
| InChIKey | NPDKATFHNLHCBE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |