C14H15Cl2F3N2O — CID 46801707
N-(2,3-dichlorophenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]acetamide (PubChem CID 46801707) has the molecular formula C14H15Cl2F3N2O and a molecular weight of 355.19 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 46801707 |
| Molecular Formula | C14H15Cl2F3N2O |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCCC(C(F)(F)F)C1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H15Cl2F3N2O/c15-10-4-1-5-11(13(10)16)20-12(22)8-21-6-2-3-9(7-21)14(17,18)19/h1,4-5,9H,2-3,6-8H2,(H,20,22) |
| InChIKey | VHLPIFUMZDWODG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |