C21H23BrN4O — CID 46802308
N-(4-bromo-2-methylphenyl)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 46802308) has the molecular formula C21H23BrN4O and a molecular weight of 427.35 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46802308 |
| Molecular Formula | C21H23BrN4O |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN1CCN(Cc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C21H23BrN4O/c1-16-12-19(22)6-7-20(16)24-21(27)15-26-10-8-25(9-11-26)14-18-4-2-17(13-23)3-5-18/h2-7,12H,8-11,14-15H2,1H3,(H,24,27) |
| InChIKey | OPKSIZPNHGFJTM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |