C16H18BrN3O2S — CID 46802526
[4-(2-bromophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-morpholin-4-ylmethanone (PubChem CID 46802526) has the molecular formula C16H18BrN3O2S and a molecular weight of 396.31 g/mol. Its IUPAC name is [4-(2-bromophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-(2-bromophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 46802526 |
| Molecular Formula | C16H18BrN3O2S |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | [4-(2-bromophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-morpholin-4-ylmethanone |
| SMILES | CC1=C(C(=O)N2CCOCC2)C(c2ccccc2Br)NC(=S)N1 |
| InChI | InChI=1S/C16H18BrN3O2S/c1-10-13(15(21)20-6-8-22-9-7-20)14(19-16(23)18-10)11-4-2-3-5-12(11)17/h2-5,14H,6-9H2,1H3,(H2,18,19,23) |
| InChIKey | ARIHETNEDINUNS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|