C20H22FNO3S — CID 46802916
3-(4-fluorophenyl)sulfanyl-N-[3-(oxolan-2-ylmethoxy)phenyl]propanamide (PubChem CID 46802916) has the molecular formula C20H22FNO3S and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-N-[3-(oxolan-2-ylmethoxy)phenyl]propanamide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-N-[3-(oxolan-2-ylmethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 46802916 |
| Molecular Formula | C20H22FNO3S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-N-[3-(oxolan-2-ylmethoxy)phenyl]propanamide |
| SMILES | O=C(CCSc1ccc(F)cc1)Nc1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C20H22FNO3S/c21-15-6-8-19(9-7-15)26-12-10-20(23)22-16-3-1-4-17(13-16)25-14-18-5-2-11-24-18/h1,3-4,6-9,13,18H,2,5,10-12,14H2,(H,22,23) |
| InChIKey | KKGWIENTQCTLFG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |