About (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate
(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate (PubChem CID 46805166) has the molecular formula C22H15F3N2O4
and a molecular weight of 428.37 g/mol. Its IUPAC name is (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate |
| PubChem CID | 46805166 |
| Molecular Formula | C22H15F3N2O4 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate |
| SMILES | Cc1cccn2c(=O)cc(COC(=O)c3ccc(-c4cccc(C(F)(F)F)c4)o3)nc12 |
| InChI | InChI=1S/C22H15F3N2O4/c1-13-4-3-9-27-19(28)11-16(26-20(13)27)12-30-21(29)18-8-7-17(31-18)14-5-2-6-15(10-14)22(23,24)25/h2-11H,12H2,1H3 |
| InChIKey | QDDYOYIEOBUQMR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate?
The IUPAC name of (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate (CID 46805166) is (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate.
What is the SMILES notation for (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate?
The canonical SMILES for (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate is Cc1cccn2c(=O)cc(COC(=O)c3ccc(-c4cccc(C(F)(F)F)c4)o3)nc12.
What is the InChIKey of (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate?
The InChIKey is QDDYOYIEOBUQMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3N2O4/c1-13-4-3-9-27-19(28)11-16(26-20(13)27)12-30-21(29)18-8-7-17(31-18)14-5-2-6-15(10-14)22(23,24)25/h2-11H,12H2,1H3.
What are the key properties of (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate?
(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate has a molecular weight of 428.37 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate is sourced from PubChem (CID 46805166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).