C15H14N4O4S — CID 46808868
ethyl N-[(3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]carbamate (PubChem CID 46808868) has the molecular formula C15H14N4O4S and a molecular weight of 346.37 g/mol. Its IUPAC name is ethyl N-[(3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]carbamate.
| Compound Name | ethyl N-[(3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]carbamate |
|---|---|
| PubChem CID | 46808868 |
| Molecular Formula | C15H14N4O4S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | ethyl N-[(3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1cc(-c2cccs2)nc2onc(C)c12 |
| InChI | InChI=1S/C15H14N4O4S/c1-3-22-15(21)18-17-13(20)9-7-10(11-5-4-6-24-11)16-14-12(9)8(2)19-23-14/h4-7H,3H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | BCHYFSTTYGFRMK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|