C20H31N3O3 — CID 46813310
N-[[1-(dimethylamino)cycloheptyl]methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetamide (PubChem CID 46813310) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cycloheptyl]methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetamide.
| Compound Name | N-[[1-(dimethylamino)cycloheptyl]methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 46813310 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | N-[[1-(dimethylamino)cycloheptyl]methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetamide |
| SMILES | CN(C)C1(CNC(=O)CN2C(=O)C3CC=CCC3C2=O)CCCCCC1 |
| InChI | InChI=1S/C20H31N3O3/c1-22(2)20(11-7-3-4-8-12-20)14-21-17(24)13-23-18(25)15-9-5-6-10-16(15)19(23)26/h5-6,15-16H,3-4,7-14H2,1-2H3,(H,21,24) |
| InChIKey | RGUQFIWFYKVKAO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|