C22H27N3OS2 — CID 4681336
N-benzyl-12-ethyl-12-methyl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 4681336) has the molecular formula C22H27N3OS2 and a molecular weight of 413.61 g/mol. Its IUPAC name is N-benzyl-12-ethyl-12-methyl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | N-benzyl-12-ethyl-12-methyl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 4681336 |
| Molecular Formula | C22H27N3OS2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-benzyl-12-ethyl-12-methyl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CCCSc1nc(NCc2ccccc2)c2c3c(sc2n1)COC(C)(CC)C3 |
| InChI | InChI=1S/C22H27N3OS2/c1-4-11-27-21-24-19(23-13-15-9-7-6-8-10-15)18-16-12-22(3,5-2)26-14-17(16)28-20(18)25-21/h6-10H,4-5,11-14H2,1-3H3,(H,23,24,25) |
| InChIKey | XAJKQKZQADCJEZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |