C23H22N4O3S2 — CID 46815681
N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide (PubChem CID 46815681) has the molecular formula C23H22N4O3S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 46815681 |
| Molecular Formula | C23H22N4O3S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide |
| SMILES | COc1ccc(-c2csc(NC(=O)CSc3ncc(-c4ccccc4)n3C)n2)c(OC)c1 |
| InChI | InChI=1S/C23H22N4O3S2/c1-27-19(15-7-5-4-6-8-15)12-24-23(27)32-14-21(28)26-22-25-18(13-31-22)17-10-9-16(29-2)11-20(17)30-3/h4-13H,14H2,1-3H3,(H,25,26,28) |
| InChIKey | BNQZFDPCEWSPDP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|