C19H16N4O7 — CID 46815946
[2-(2-methyl-3-nitroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate (PubChem CID 46815946) has the molecular formula C19H16N4O7 and a molecular weight of 412.36 g/mol. Its IUPAC name is [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate.
| Compound Name | [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate |
|---|---|
| PubChem CID | 46815946 |
| Molecular Formula | C19H16N4O7 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate |
| SMILES | Cc1c(NC(=O)COC(=O)Cn2nc(-c3ccccc3)oc2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N4O7/c1-12-14(8-5-9-15(12)23(27)28)20-16(24)11-29-17(25)10-22-19(26)30-18(21-22)13-6-3-2-4-7-13/h2-9H,10-11H2,1H3,(H,20,24) |
| InChIKey | DCAZBJITSIIZMI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 146.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|