C16H13N3O2S — CID 4681651
3-phenylspiro[1,3,4-thiadiazinane-2,3'-1H-indole]-2',5-dione (PubChem CID 4681651) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 3-phenylspiro[1,3,4-thiadiazinane-2,3'-1H-indole]-2',5-dione.
| Compound Name | 3-phenylspiro[1,3,4-thiadiazinane-2,3'-1H-indole]-2',5-dione |
|---|---|
| PubChem CID | 4681651 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-phenylspiro[1,3,4-thiadiazinane-2,3'-1H-indole]-2',5-dione |
| SMILES | O=C1CSC2(C(=O)Nc3ccccc32)N(c2ccccc2)N1 |
| InChI | InChI=1S/C16H13N3O2S/c20-14-10-22-16(19(18-14)11-6-2-1-3-7-11)12-8-4-5-9-13(12)17-15(16)21/h1-9H,10H2,(H,17,21)(H,18,20) |
| InChIKey | BANXUIONNXOYAU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |