About 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide
3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide (PubChem CID 4681801) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide.
Molecular Properties
| Compound Name | 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide |
| PubChem CID | 4681801 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide |
| SMILES | CCCN(CCC)C(=O)C=Cc1ccc(C)o1 |
| InChI | InChI=1S/C14H21NO2/c1-4-10-15(11-5-2)14(16)9-8-13-7-6-12(3)17-13/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | CXVWQFRCYYHHRD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide?
The IUPAC name of 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide (CID 4681801) is 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide.
What is the SMILES notation for 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide?
The canonical SMILES for 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide is CCCN(CCC)C(=O)C=Cc1ccc(C)o1.
What is the InChIKey of 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide?
The InChIKey is CXVWQFRCYYHHRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-4-10-15(11-5-2)14(16)9-8-13-7-6-12(3)17-13/h6-9H,4-5,10-11H2,1-3H3.
What are the key properties of 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide?
3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide has a molecular weight of 235.33 g/mol, XLogP of 3.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methylfuran-2-yl)-N,N-dipropylprop-2-enamide is sourced from PubChem (CID 4681801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).