C26H24N4O3 — CID 4681939
2,7,9-trimethyl-5-[4-[(4-nitrophenyl)methoxy]phenyl]-5,6-dihydropyrazolo[1,5-c]quinazoline (PubChem CID 4681939) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2,7,9-trimethyl-5-[4-[(4-nitrophenyl)methoxy]phenyl]-5,6-dihydropyrazolo[1,5-c]quinazoline.
| Compound Name | 2,7,9-trimethyl-5-[4-[(4-nitrophenyl)methoxy]phenyl]-5,6-dihydropyrazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 4681939 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2,7,9-trimethyl-5-[4-[(4-nitrophenyl)methoxy]phenyl]-5,6-dihydropyrazolo[1,5-c]quinazoline |
| SMILES | Cc1cc(C)c2c(c1)-c1cc(C)nn1C(c1ccc(OCc3ccc([N+](=O)[O-])cc3)cc1)N2 |
| InChI | InChI=1S/C26H24N4O3/c1-16-12-17(2)25-23(13-16)24-14-18(3)28-29(24)26(27-25)20-6-10-22(11-7-20)33-15-19-4-8-21(9-5-19)30(31)32/h4-14,26-27H,15H2,1-3H3 |
| InChIKey | LHAPLBPVWMBAGJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|