C21H21N3O4 — CID 46819586
[1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-benzamidobutanoate (PubChem CID 46819586) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is [1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-benzamidobutanoate.
| Compound Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 46819586 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OC(C)C(=O)Nc1cccc(C#N)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O4/c1-14(23-21(27)17-8-4-3-5-9-17)11-19(25)28-15(2)20(26)24-18-10-6-7-16(12-18)13-22/h3-10,12,14-15H,11H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | BFBIWNWFQYAWRO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |