C16H19NO5S — CID 4682093
5-[(4-methoxyphenyl)sulfonylmethyl]-N-propan-2-ylfuran-2-carboxamide (PubChem CID 4682093) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)sulfonylmethyl]-N-propan-2-ylfuran-2-carboxamide.
| Compound Name | 5-[(4-methoxyphenyl)sulfonylmethyl]-N-propan-2-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 4682093 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 5-[(4-methoxyphenyl)sulfonylmethyl]-N-propan-2-ylfuran-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)Cc2ccc(C(=O)NC(C)C)o2)cc1 |
| InChI | InChI=1S/C16H19NO5S/c1-11(2)17-16(18)15-9-6-13(22-15)10-23(19,20)14-7-4-12(21-3)5-8-14/h4-9,11H,10H2,1-3H3,(H,17,18) |
| InChIKey | JNKNQRIMWPGZOB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |