About 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride
4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride (PubChem CID 46820996) has the molecular formula C17H19ClN4O2S2
and a molecular weight of 410.95 g/mol. Its IUPAC name is 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride |
| PubChem CID | 46820996 |
| Molecular Formula | C17H19ClN4O2S2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride |
| SMILES | CN1CCN(S(=O)(=O)c2cccc3nsnc23)C(c2ccccc2)C1.Cl |
| InChI | InChI=1S/C17H18N4O2S2.ClH/c1-20-10-11-21(15(12-20)13-6-3-2-4-7-13)25(22,23)16-9-5-8-14-17(16)19-24-18-14;/h2-9,15H,10-12H2,1H3;1H |
| InChIKey | JREMQQSXESLUCE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride?
The IUPAC name of 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride (CID 46820996) is 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride.
What is the SMILES notation for 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride?
The canonical SMILES for 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride is CN1CCN(S(=O)(=O)c2cccc3nsnc23)C(c2ccccc2)C1.Cl.
What is the InChIKey of 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride?
The InChIKey is JREMQQSXESLUCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O2S2.ClH/c1-20-10-11-21(15(12-20)13-6-3-2-4-7-13)25(22,23)16-9-5-8-14-17(16)19-24-18-14;/h2-9,15H,10-12H2,1H3;1H.
What are the key properties of 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride?
4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride has a molecular weight of 410.95 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-2-phenylpiperazin-1-yl)sulfonyl-2,1,3-benzothiadiazole;hydrochloride is sourced from PubChem (CID 46820996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).